C15H21NO4 — CID 130276978
(7-methyl-1,3-dioxo-2-propyl-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl acetate (PubChem CID 130276978) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (7-methyl-1,3-dioxo-2-propyl-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl acetate.
| Compound Name | (7-methyl-1,3-dioxo-2-propyl-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl acetate |
|---|---|
| PubChem CID | 130276978 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (7-methyl-1,3-dioxo-2-propyl-3a,4,7,7a-tetrahydroisoindol-4-yl)methyl acetate |
| SMILES | CCCN1C(=O)C2C(C)C=CC(COC(C)=O)C2C1=O |
| InChI | InChI=1S/C15H21NO4/c1-4-7-16-14(18)12-9(2)5-6-11(8-20-10(3)17)13(12)15(16)19/h5-6,9,11-13H,4,7-8H2,1-3H3 |
| InChIKey | DIWMWMNQNYWBAD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|