About butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate
butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate (PubChem CID 130277169) has the molecular formula C24H44O6S4
and a molecular weight of 556.88 g/mol. Its IUPAC name is butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate.
Molecular Properties
| Compound Name | butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate |
| PubChem CID | 130277169 |
| Molecular Formula | C24H44O6S4 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate |
| SMILES | CCCC.CCOC(=O)CCC(CCC(CCC(=O)OCC)SC(=S)OCC)SC(=S)OCC |
| InChI | InChI=1S/C20H34O6S4.C4H10/c1-5-23-17(21)13-11-15(29-19(27)25-7-3)9-10-16(30-20(28)26-8-4)12-14-18(22)24-6-2;1-3-4-2/h15-16H,5-14H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | QRRUANFNXSKUAH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate?
The IUPAC name of butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate (CID 130277169) is butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate.
What is the SMILES notation for butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate?
The canonical SMILES for butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate is CCCC.CCOC(=O)CCC(CCC(CCC(=O)OCC)SC(=S)OCC)SC(=S)OCC.
What is the InChIKey of butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate?
The InChIKey is QRRUANFNXSKUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O6S4.C4H10/c1-5-23-17(21)13-11-15(29-19(27)25-7-3)9-10-16(30-20(28)26-8-4)12-14-18(22)24-6-2;1-3-4-2/h15-16H,5-14H2,1-4H3;3-4H2,1-2H3.
What are the key properties of butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate?
butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate has a molecular weight of 556.88 g/mol, XLogP of 7.11, 16 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for butane;diethyl 4,7-bis(ethoxycarbothioylsulfanyl)decanedioate is sourced from PubChem (CID 130277169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).