About 3,4-di(propan-2-yl)-1,3-thiazepane
3,4-di(propan-2-yl)-1,3-thiazepane (PubChem CID 130277192) has the molecular formula C11H23NS
and a molecular weight of 201.38 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,3-thiazepane.
Molecular Properties
| Compound Name | 3,4-di(propan-2-yl)-1,3-thiazepane |
| PubChem CID | 130277192 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,3-thiazepane |
| SMILES | CC(C)C1CCCSCN1C(C)C |
| InChI | InChI=1S/C11H23NS/c1-9(2)11-6-5-7-13-8-12(11)10(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | OCQAHAGQFLOOGU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-di(propan-2-yl)-1,3-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-di(propan-2-yl)-1,3-thiazepane?
The IUPAC name of 3,4-di(propan-2-yl)-1,3-thiazepane (CID 130277192) is 3,4-di(propan-2-yl)-1,3-thiazepane.
What is the SMILES notation for 3,4-di(propan-2-yl)-1,3-thiazepane?
The canonical SMILES for 3,4-di(propan-2-yl)-1,3-thiazepane is CC(C)C1CCCSCN1C(C)C.
What is the InChIKey of 3,4-di(propan-2-yl)-1,3-thiazepane?
The InChIKey is OCQAHAGQFLOOGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS/c1-9(2)11-6-5-7-13-8-12(11)10(3)4/h9-11H,5-8H2,1-4H3.
What are the key properties of 3,4-di(propan-2-yl)-1,3-thiazepane?
3,4-di(propan-2-yl)-1,3-thiazepane has a molecular weight of 201.38 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-di(propan-2-yl)-1,3-thiazepane is sourced from PubChem (CID 130277192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).