About 2-amino-3,6,7-trimethylpteridin-4-one
2-amino-3,6,7-trimethylpteridin-4-one (PubChem CID 13027744) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-amino-3,6,7-trimethylpteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-3,6,7-trimethylpteridin-4-one |
| PubChem CID | 13027744 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-amino-3,6,7-trimethylpteridin-4-one |
| SMILES | Cc1nc2nc(N)n(C)c(=O)c2nc1C |
| InChI | InChI=1S/C9H11N5O/c1-4-5(2)12-7-6(11-4)8(15)14(3)9(10)13-7/h1-3H3,(H2,10,12,13) |
| InChIKey | XDWUQCOTXWVWPV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3,6,7-trimethylpteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,6,7-trimethylpteridin-4-one?
The IUPAC name of 2-amino-3,6,7-trimethylpteridin-4-one (CID 13027744) is 2-amino-3,6,7-trimethylpteridin-4-one.
What is the SMILES notation for 2-amino-3,6,7-trimethylpteridin-4-one?
The canonical SMILES for 2-amino-3,6,7-trimethylpteridin-4-one is Cc1nc2nc(N)n(C)c(=O)c2nc1C.
What is the InChIKey of 2-amino-3,6,7-trimethylpteridin-4-one?
The InChIKey is XDWUQCOTXWVWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-4-5(2)12-7-6(11-4)8(15)14(3)9(10)13-7/h1-3H3,(H2,10,12,13).
What are the key properties of 2-amino-3,6,7-trimethylpteridin-4-one?
2-amino-3,6,7-trimethylpteridin-4-one has a molecular weight of 205.22 g/mol, XLogP of -0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,6,7-trimethylpteridin-4-one is sourced from PubChem (CID 13027744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).