C8H8F10N2 — CID 130277887
1,1,2,2-tetrafluoro-N'-prop-1-en-2-yl-N,N-bis(trifluoromethyl)propane-1,3-diamine (PubChem CID 130277887) has the molecular formula C8H8F10N2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-N'-prop-1-en-2-yl-N,N-bis(trifluoromethyl)propane-1,3-diamine.
| Compound Name | 1,1,2,2-tetrafluoro-N'-prop-1-en-2-yl-N,N-bis(trifluoromethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 130277887 |
| Molecular Formula | C8H8F10N2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-N'-prop-1-en-2-yl-N,N-bis(trifluoromethyl)propane-1,3-diamine |
| SMILES | C=C(C)NCC(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10N2/c1-4(2)19-3-5(9,10)6(11,12)20(7(13,14)15)8(16,17)18/h19H,1,3H2,2H3 |
| InChIKey | ALEAXXVSIOZVTJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|