C25H26F5N5O — CID 130278015
4-[1-[(1,4-difluoro-4-methylcyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 130278015) has the molecular formula C25H26F5N5O and a molecular weight of 507.51 g/mol. Its IUPAC name is 4-[1-[(1,4-difluoro-4-methylcyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-[(1,4-difluoro-4-methylcyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 130278015 |
| Molecular Formula | C25H26F5N5O |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 4-[1-[(1,4-difluoro-4-methylcyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3(F)CCC(C)(F)CC3)c2c1 |
| InChI | InChI=1S/C25H26F5N5O/c1-15-21(16(2)36-33-15)17-8-20-22(31-9-17)19(18-10-32-35(11-18)14-25(28,29)30)12-34(20)13-24(27)6-4-23(3,26)5-7-24/h8-12H,4-7,13-14H2,1-3H3 |
| InChIKey | INOUOPAFZUOBJF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|