C23H23FN6O5S — CID 130278253
1-[(4-fluorophenyl)methyl]-3-[3-hydroxy-2-(hydroxymethyl)propyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione (PubChem CID 130278253) has the molecular formula C23H23FN6O5S and a molecular weight of 514.54 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[3-hydroxy-2-(hydroxymethyl)propyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[3-hydroxy-2-(hydroxymethyl)propyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 130278253 |
| Molecular Formula | C23H23FN6O5S |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[3-hydroxy-2-(hydroxymethyl)propyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione |
| SMILES | Cc1nsc(Oc2ccc(Nc3nc(=O)n(CC(CO)CO)c(=O)n3Cc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C23H23FN6O5S/c1-14-25-22(36-28-14)35-19-8-6-18(7-9-19)26-20-27-21(33)30(11-16(12-31)13-32)23(34)29(20)10-15-2-4-17(24)5-3-15/h2-9,16,31-32H,10-13H2,1H3,(H,26,27,33) |
| InChIKey | KFMQLKCQFHYGPW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |