C22H21FN6O5S — CID 130278254
3-[(2S)-2,3-dihydroxypropyl]-1-[(4-fluorophenyl)methyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione (PubChem CID 130278254) has the molecular formula C22H21FN6O5S and a molecular weight of 500.51 g/mol. Its IUPAC name is 3-[(2S)-2,3-dihydroxypropyl]-1-[(4-fluorophenyl)methyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione.
| Compound Name | 3-[(2S)-2,3-dihydroxypropyl]-1-[(4-fluorophenyl)methyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 130278254 |
| Molecular Formula | C22H21FN6O5S |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 3-[(2S)-2,3-dihydroxypropyl]-1-[(4-fluorophenyl)methyl]-6-[4-[(3-methyl-1,2,4-thiadiazol-5-yl)oxy]anilino]-1,3,5-triazine-2,4-dione |
| SMILES | Cc1nsc(Oc2ccc(Nc3nc(=O)n(C[C@H](O)CO)c(=O)n3Cc3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C22H21FN6O5S/c1-13-24-21(35-27-13)34-18-8-6-16(7-9-18)25-19-26-20(32)29(11-17(31)12-30)22(33)28(19)10-14-2-4-15(23)5-3-14/h2-9,17,30-31H,10-12H2,1H3,(H,25,26,32)/t17-/m0/s1 |
| InChIKey | CXEMXDSLLWAXPD-KRWDZBQOSA-N |
| XLogP | 1.64 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |