C24H23ClN6O5 — CID 130278345
methyl (2S)-3-[3-[(4-chlorophenyl)methyl]-4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoate (PubChem CID 130278345) has the molecular formula C24H23ClN6O5 and a molecular weight of 510.94 g/mol. Its IUPAC name is methyl (2S)-3-[3-[(4-chlorophenyl)methyl]-4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[3-[(4-chlorophenyl)methyl]-4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 130278345 |
| Molecular Formula | C24H23ClN6O5 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | methyl (2S)-3-[3-[(4-chlorophenyl)methyl]-4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]-2,6-dioxo-1,3,5-triazin-1-yl]-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)Cn1c(=O)nc(Nc2ccc(-c3noc(C)n3)cc2)n(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H23ClN6O5/c1-14(21(32)35-3)12-31-23(33)28-22(30(24(31)34)13-16-4-8-18(25)9-5-16)27-19-10-6-17(7-11-19)20-26-15(2)36-29-20/h4-11,14H,12-13H2,1-3H3,(H,27,28,33)/t14-/m0/s1 |
| InChIKey | FVYWILAALIXFAR-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |