C30H34ClN5O4 — CID 130278553
(2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(9-propan-2-yl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid (PubChem CID 130278553) has the molecular formula C30H34ClN5O4 and a molecular weight of 564.09 g/mol. Its IUPAC name is (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(9-propan-2-yl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid.
| Compound Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(9-propan-2-yl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 130278553 |
| Molecular Formula | C30H34ClN5O4 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (2R,3S)-3-[3-[(4-chlorophenyl)methyl]-2,6-dioxo-4-[(9-propan-2-yl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]-1,3,5-triazin-1-yl]-2-methylbutanoic acid |
| SMILES | CC(C)n1c2c(c3cc(Nc4nc(=O)n([C@@H](C)[C@@H](C)C(=O)O)c(=O)n4Cc4ccc(Cl)cc4)ccc31)CCCC2 |
| InChI | InChI=1S/C30H34ClN5O4/c1-17(2)35-25-8-6-5-7-23(25)24-15-22(13-14-26(24)35)32-28-33-29(39)36(19(4)18(3)27(37)38)30(40)34(28)16-20-9-11-21(31)12-10-20/h9-15,17-19H,5-8,16H2,1-4H3,(H,37,38)(H,32,33,39)/t18-,19+/m1/s1 |
| InChIKey | SLRQVYFVXJKXNC-MOPGFXCFSA-N |
| XLogP | 5.55 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |