C25H29ClN4O5 — CID 130278616
5-[4-(3-chloro-4-propan-2-yloxyanilino)-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]pentanoic acid (PubChem CID 130278616) has the molecular formula C25H29ClN4O5 and a molecular weight of 500.98 g/mol. Its IUPAC name is 5-[4-(3-chloro-4-propan-2-yloxyanilino)-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]pentanoic acid.
| Compound Name | 5-[4-(3-chloro-4-propan-2-yloxyanilino)-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 130278616 |
| Molecular Formula | C25H29ClN4O5 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 5-[4-(3-chloro-4-propan-2-yloxyanilino)-3-[(4-methylphenyl)methyl]-2,6-dioxo-1,3,5-triazin-1-yl]pentanoic acid |
| SMILES | Cc1ccc(Cn2c(Nc3ccc(OC(C)C)c(Cl)c3)nc(=O)n(CCCCC(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C25H29ClN4O5/c1-16(2)35-21-12-11-19(14-20(21)26)27-23-28-24(33)29(13-5-4-6-22(31)32)25(34)30(23)15-18-9-7-17(3)8-10-18/h7-12,14,16H,4-6,13,15H2,1-3H3,(H,31,32)(H,27,28,33) |
| InChIKey | WUERGSVWDUBJRQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|