About (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine
(Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine (PubChem CID 130278885) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine |
| PubChem CID | 130278885 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine |
| SMILES | CCC1N=CN/C1=C/C=C\N |
| InChI | InChI=1S/C8H13N3/c1-2-7-8(4-3-5-9)11-6-10-7/h3-7H,2,9H2,1H3,(H,10,11)/b5-3-,8-4+ |
| InChIKey | WRVSPGVDQHNYEW-VOGDQUTBSA-N |
| XLogP | 0.75 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine?
The IUPAC name of (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine (CID 130278885) is (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine.
What is the SMILES notation for (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine?
The canonical SMILES for (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine is CCC1N=CN/C1=C/C=C\N.
What is the InChIKey of (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine?
The InChIKey is WRVSPGVDQHNYEW-VOGDQUTBSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-7-8(4-3-5-9)11-6-10-7/h3-7H,2,9H2,1H3,(H,10,11)/b5-3-,8-4+.
What are the key properties of (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine?
(Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine has a molecular weight of 151.21 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,3E)-3-(4-ethyl-1,4-dihydroimidazol-5-ylidene)prop-1-en-1-amine is sourced from PubChem (CID 130278885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).