C27H28F3N7O — CID 130278903
3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-(5,5,8-trifluorooctyl)pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole (PubChem CID 130278903) has the molecular formula C27H28F3N7O and a molecular weight of 523.56 g/mol. Its IUPAC name is 3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-(5,5,8-trifluorooctyl)pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-(5,5,8-trifluorooctyl)pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 130278903 |
| Molecular Formula | C27H28F3N7O |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 3,5-dimethyl-4-[3-[4-(2H-tetrazol-5-yl)phenyl]-1-(5,5,8-trifluorooctyl)pyrrolo[3,2-b]pyridin-6-yl]-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3ccc(-c4nn[nH]n4)cc3)cn(CCCCC(F)(F)CCCF)c2c1 |
| InChI | InChI=1S/C27H28F3N7O/c1-17-24(18(2)38-34-17)21-14-23-25(31-15-21)22(19-6-8-20(9-7-19)26-32-35-36-33-26)16-37(23)13-4-3-10-27(29,30)11-5-12-28/h6-9,14-16H,3-5,10-13H2,1-2H3,(H,32,33,35,36) |
| InChIKey | GSVUITFVNKHKLK-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|