About (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene
(2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene (PubChem CID 130278923) has the molecular formula C12H16S
and a molecular weight of 192.33 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene.
Molecular Properties
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene |
| PubChem CID | 130278923 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene |
| SMILES | C/C=C\c1sc(=C/C)/c(=C\C)c1C |
| InChI | InChI=1S/C12H16S/c1-5-8-12-9(4)10(6-2)11(7-3)13-12/h5-8H,1-4H3/b8-5-,10-6-,11-7+ |
| InChIKey | UQWDKZXEBJTSAP-OHCOKWNNSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene?
The IUPAC name of (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene (CID 130278923) is (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene.
What is the SMILES notation for (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene?
The canonical SMILES for (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene is C/C=C\c1sc(=C/C)/c(=C\C)c1C.
What is the InChIKey of (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene?
The InChIKey is UQWDKZXEBJTSAP-OHCOKWNNSA-N. The full InChI is InChI=1S/C12H16S/c1-5-8-12-9(4)10(6-2)11(7-3)13-12/h5-8H,1-4H3/b8-5-,10-6-,11-7+.
What are the key properties of (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene?
(2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene has a molecular weight of 192.33 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2,3-di(ethylidene)-4-methyl-5-[(Z)-prop-1-enyl]thiophene is sourced from PubChem (CID 130278923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).