C18H20N2O7 — CID 130278934
3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoic acid (PubChem CID 130278934) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoic acid.
| Compound Name | 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoic acid |
|---|---|
| PubChem CID | 130278934 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-[5-(3-ethoxy-3-oxopropyl)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]propanoic acid |
| SMILES | CCOC(=O)CCC1(CCC(=O)O)C(=O)NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H20N2O7/c1-2-27-14(23)9-11-18(10-8-13(21)22)15(24)19-17(26)20(16(18)25)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,21,22)(H,19,24,26) |
| InChIKey | IRQQYQNUTRSOKL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|