C25H29IN4O5 — CID 130279117
1-[(4-iodophenyl)methyl]-3-[(2S)-2-(3-methoxyoxiran-2-yl)propyl]-6-(4-propan-2-yloxyanilino)-1,3,5-triazine-2,4-dione (PubChem CID 130279117) has the molecular formula C25H29IN4O5 and a molecular weight of 592.43 g/mol. Its IUPAC name is 1-[(4-iodophenyl)methyl]-3-[(2S)-2-(3-methoxyoxiran-2-yl)propyl]-6-(4-propan-2-yloxyanilino)-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(4-iodophenyl)methyl]-3-[(2S)-2-(3-methoxyoxiran-2-yl)propyl]-6-(4-propan-2-yloxyanilino)-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 130279117 |
| Molecular Formula | C25H29IN4O5 |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | 1-[(4-iodophenyl)methyl]-3-[(2S)-2-(3-methoxyoxiran-2-yl)propyl]-6-(4-propan-2-yloxyanilino)-1,3,5-triazine-2,4-dione |
| SMILES | COC1OC1[C@@H](C)Cn1c(=O)nc(Nc2ccc(OC(C)C)cc2)n(Cc2ccc(I)cc2)c1=O |
| InChI | InChI=1S/C25H29IN4O5/c1-15(2)34-20-11-9-19(10-12-20)27-23-28-24(31)30(13-16(3)21-22(33-4)35-21)25(32)29(23)14-17-5-7-18(26)8-6-17/h5-12,15-16,21-22H,13-14H2,1-4H3,(H,27,28,31)/t16-,21?,22?/m0/s1 |
| InChIKey | UWEFMOQAHLHQIB-XDGVHFHYSA-N |
| XLogP | 3.60 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|