C17H23F3O6 — CID 130279187
[(4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,2-trifluoroacetate (PubChem CID 130279187) has the molecular formula C17H23F3O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is [(4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 130279187 |
| Molecular Formula | C17H23F3O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(OC(=O)C(F)(F)F)O[C@@H]3OC4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C17H23F3O6/c1-8-4-5-11-9(2)12(22-13(21)17(18,19)20)23-14-16(11)10(8)6-7-15(3,24-14)25-26-16/h8-12,14H,4-7H2,1-3H3/t8-,9-,10+,11+,12?,14-,15?,16-/m1/s1 |
| InChIKey | ZOTNYRGALRIRTJ-WFLPCDKMSA-N |
| XLogP | 3.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|