About 1-phenylprop-2-en-1-one
1-phenylprop-2-en-1-one (PubChem CID 13028) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is 1-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-phenylprop-2-en-1-one |
| PubChem CID | 13028 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 1-phenylprop-2-en-1-one |
| SMILES | C=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H8O/c1-2-9(10)8-6-4-3-5-7-8/h2-7H,1H2 |
| InChIKey | KUIZKZHDMPERHR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylprop-2-en-1-one?
The IUPAC name of 1-phenylprop-2-en-1-one (CID 13028) is 1-phenylprop-2-en-1-one.
What is the SMILES notation for 1-phenylprop-2-en-1-one?
The canonical SMILES for 1-phenylprop-2-en-1-one is C=CC(=O)c1ccccc1.
What is the InChIKey of 1-phenylprop-2-en-1-one?
The InChIKey is KUIZKZHDMPERHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O/c1-2-9(10)8-6-4-3-5-7-8/h2-7H,1H2.
What are the key properties of 1-phenylprop-2-en-1-one?
1-phenylprop-2-en-1-one has a molecular weight of 132.16 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylprop-2-en-1-one is sourced from PubChem (CID 13028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).