C13H14O6 — CID 130280331
4,6,12-trioxatetracyclo[8.3.2.12,8.01,9]hexadecane-7,11,13-trione (PubChem CID 130280331) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4,6,12-trioxatetracyclo[8.3.2.12,8.01,9]hexadecane-7,11,13-trione.
| Compound Name | 4,6,12-trioxatetracyclo[8.3.2.12,8.01,9]hexadecane-7,11,13-trione |
|---|---|
| PubChem CID | 130280331 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4,6,12-trioxatetracyclo[8.3.2.12,8.01,9]hexadecane-7,11,13-trione |
| SMILES | O=C1OCOCC2CC1C1C3CCC21C(=O)OC3=O |
| InChI | InChI=1S/C13H14O6/c14-10-8-3-6(4-17-5-18-10)13-2-1-7(9(8)13)11(15)19-12(13)16/h6-9H,1-5H2 |
| InChIKey | OBCSAAWJUZYDKF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|