About 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine
6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine (PubChem CID 130281186) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine.
Molecular Properties
| Compound Name | 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine |
| PubChem CID | 130281186 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine |
| SMILES | C=C(C(C)C)C(N)CCCN/C=C\C |
| InChI | InChI=1S/C12H24N2/c1-5-8-14-9-6-7-12(13)11(4)10(2)3/h5,8,10,12,14H,4,6-7,9,13H2,1-3H3/b8-5- |
| InChIKey | ZKCVQZJFIIWQEO-YVMONPNESA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine?
The IUPAC name of 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine (CID 130281186) is 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine.
What is the SMILES notation for 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine?
The canonical SMILES for 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine is C=C(C(C)C)C(N)CCCN/C=C\C.
What is the InChIKey of 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine?
The InChIKey is ZKCVQZJFIIWQEO-YVMONPNESA-N. The full InChI is InChI=1S/C12H24N2/c1-5-8-14-9-6-7-12(13)11(4)10(2)3/h5,8,10,12,14H,4,6-7,9,13H2,1-3H3/b8-5-.
What are the key properties of 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine?
6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine has a molecular weight of 196.34 g/mol, XLogP of 2.43, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-methylidene-1-N-[(Z)-prop-1-enyl]heptane-1,4-diamine is sourced from PubChem (CID 130281186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).