About 3-methyl-5,6-dihydro-1H-indole-5,6-diol
3-methyl-5,6-dihydro-1H-indole-5,6-diol (PubChem CID 130281203) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-methyl-5,6-dihydro-1H-indole-5,6-diol.
Molecular Properties
| Compound Name | 3-methyl-5,6-dihydro-1H-indole-5,6-diol |
| PubChem CID | 130281203 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-methyl-5,6-dihydro-1H-indole-5,6-diol |
| SMILES | Cc1c[nH]c2c1=CC(O)C(O)C=2 |
| InChI | InChI=1S/C9H11NO2/c1-5-4-10-7-3-9(12)8(11)2-6(5)7/h2-4,8-12H,1H3 |
| InChIKey | GAKKUPLWPQYTRK-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5,6-dihydro-1H-indole-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-dihydro-1H-indole-5,6-diol?
The IUPAC name of 3-methyl-5,6-dihydro-1H-indole-5,6-diol (CID 130281203) is 3-methyl-5,6-dihydro-1H-indole-5,6-diol.
What is the SMILES notation for 3-methyl-5,6-dihydro-1H-indole-5,6-diol?
The canonical SMILES for 3-methyl-5,6-dihydro-1H-indole-5,6-diol is Cc1c[nH]c2c1=CC(O)C(O)C=2.
What is the InChIKey of 3-methyl-5,6-dihydro-1H-indole-5,6-diol?
The InChIKey is GAKKUPLWPQYTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-5-4-10-7-3-9(12)8(11)2-6(5)7/h2-4,8-12H,1H3.
What are the key properties of 3-methyl-5,6-dihydro-1H-indole-5,6-diol?
3-methyl-5,6-dihydro-1H-indole-5,6-diol has a molecular weight of 165.19 g/mol, XLogP of -1.38, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-dihydro-1H-indole-5,6-diol is sourced from PubChem (CID 130281203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).