C28H45N3O — CID 130281238
(2E)-3-[[[(1E,3Z)-1-(dimethylamino)-4-methylhexa-1,3,5-trien-2-yl]-methylamino]-[(1S)-4-ethylcyclohex-2-en-1-yl]methyl]-4-methyl-2-(propylamino)penta-2,4-dienal (PubChem CID 130281238) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is (2E)-3-[[[(1E,3Z)-1-(dimethylamino)-4-methylhexa-1,3,5-trien-2-yl]-methylamino]-[(1S)-4-ethylcyclohex-2-en-1-yl]methyl]-4-methyl-2-(propylamino)penta-2,4-dienal.
| Compound Name | (2E)-3-[[[(1E,3Z)-1-(dimethylamino)-4-methylhexa-1,3,5-trien-2-yl]-methylamino]-[(1S)-4-ethylcyclohex-2-en-1-yl]methyl]-4-methyl-2-(propylamino)penta-2,4-dienal |
|---|---|
| PubChem CID | 130281238 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | (2E)-3-[[[(1E,3Z)-1-(dimethylamino)-4-methylhexa-1,3,5-trien-2-yl]-methylamino]-[(1S)-4-ethylcyclohex-2-en-1-yl]methyl]-4-methyl-2-(propylamino)penta-2,4-dienal |
| SMILES | C=CC(C)=C/C(=C\N(C)C)N(C)C(/C(C(=C)C)=C(\C=O)NCCC)[C@@H]1C=CC(CC)CC1 |
| InChI | InChI=1S/C28H45N3O/c1-10-17-29-26(20-32)27(21(4)5)28(24-15-13-23(12-3)14-16-24)31(9)25(19-30(7)8)18-22(6)11-2/h11,13,15,18-20,23-24,28-29H,2,4,10,12,14,16-17H2,1,3,5-9H3/b22-18-,25-19+,27-26+/t23?,24-,28?/m1/s1 |
| InChIKey | GUXFXKRHEIZMJQ-SWAIHFFNSA-N |
| XLogP | 5.84 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|