C10H18N2 — CID 130281265
1-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-1-N,1-N'-dimethylethane-1,1-diamine (PubChem CID 130281265) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-1-N,1-N'-dimethylethane-1,1-diamine.
| Compound Name | 1-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-1-N,1-N'-dimethylethane-1,1-diamine |
|---|---|
| PubChem CID | 130281265 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-N'-[(3Z)-hexa-1,3,5-trien-2-yl]-1-N,1-N'-dimethylethane-1,1-diamine |
| SMILES | C=C/C=C\C(=C)N(C)C(C)NC |
| InChI | InChI=1S/C10H18N2/c1-6-7-8-9(2)12(5)10(3)11-4/h6-8,10-11H,1-2H2,3-5H3/b8-7- |
| InChIKey | FPEALCHSKARDKD-FPLPWBNLSA-N |
| XLogP | 1.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|