About (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole
(3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole (PubChem CID 130281333) has the molecular formula C10H14INO2
and a molecular weight of 307.13 g/mol. Its IUPAC name is (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole.
Molecular Properties
| Compound Name | (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole |
| PubChem CID | 130281333 |
| Molecular Formula | C10H14INO2 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole |
| SMILES | CO/C(C)=C(/C=C1/C=CN(I)C1)OC |
| InChI | InChI=1S/C10H14INO2/c1-8(13-2)10(14-3)6-9-4-5-12(11)7-9/h4-6H,7H2,1-3H3/b9-6-,10-8- |
| InChIKey | GCTSSDGWYXZTPE-PTKGMRGESA-N |
| XLogP | 2.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole?
The IUPAC name of (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole (CID 130281333) is (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole.
What is the SMILES notation for (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole?
The canonical SMILES for (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole is CO/C(C)=C(/C=C1/C=CN(I)C1)OC.
What is the InChIKey of (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole?
The InChIKey is GCTSSDGWYXZTPE-PTKGMRGESA-N. The full InChI is InChI=1S/C10H14INO2/c1-8(13-2)10(14-3)6-9-4-5-12(11)7-9/h4-6H,7H2,1-3H3/b9-6-,10-8-.
What are the key properties of (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole?
(3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole has a molecular weight of 307.13 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(Z)-2,3-dimethoxybut-2-enylidene]-1-iodo-2H-pyrrole is sourced from PubChem (CID 130281333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).