C27H42O4 — CID 130281443
2-O-(2,3,3-trimethylbutan-2-yl) 6-O-(2,4,4-trimethylpentan-2-yl) 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate (PubChem CID 130281443) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-O-(2,3,3-trimethylbutan-2-yl) 6-O-(2,4,4-trimethylpentan-2-yl) 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate.
| Compound Name | 2-O-(2,3,3-trimethylbutan-2-yl) 6-O-(2,4,4-trimethylpentan-2-yl) 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 130281443 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 2-O-(2,3,3-trimethylbutan-2-yl) 6-O-(2,4,4-trimethylpentan-2-yl) 1,2,3,4-tetrahydronaphthalene-2,6-dicarboxylate |
| SMILES | CC(C)(C)CC(C)(C)OC(=O)c1ccc2c(c1)CCC(C(=O)OC(C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C27H42O4/c1-24(2,3)17-26(7,8)30-22(28)20-13-11-19-16-21(14-12-18(19)15-20)23(29)31-27(9,10)25(4,5)6/h11,13,15,21H,12,14,16-17H2,1-10H3 |
| InChIKey | PDPDZXZYEQDGDT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |