C19H26F2O — CID 130281595
2-cyclohexyl-5-[(4Z,6Z)-3,8-difluoroocta-4,6-dien-1-yn-4-yl]oxane (PubChem CID 130281595) has the molecular formula C19H26F2O and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-cyclohexyl-5-[(4Z,6Z)-3,8-difluoroocta-4,6-dien-1-yn-4-yl]oxane.
| Compound Name | 2-cyclohexyl-5-[(4Z,6Z)-3,8-difluoroocta-4,6-dien-1-yn-4-yl]oxane |
|---|---|
| PubChem CID | 130281595 |
| Molecular Formula | C19H26F2O |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-cyclohexyl-5-[(4Z,6Z)-3,8-difluoroocta-4,6-dien-1-yn-4-yl]oxane |
| SMILES | C#CC(F)/C(=C\C=C/CF)C1CCC(C2CCCCC2)OC1 |
| InChI | InChI=1S/C19H26F2O/c1-2-18(21)17(10-6-7-13-20)16-11-12-19(22-14-16)15-8-4-3-5-9-15/h1,6-7,10,15-16,18-19H,3-5,8-9,11-14H2/b7-6-,17-10- |
| InChIKey | MIABPIVYEDJFBZ-IVADJXMLSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|