C13H18N2 — CID 130282245
(1Z,3Z,6E,8Z)-6-methyl-5-methylidene-10-methyliminodeca-1,3,6,8-tetraen-1-amine (PubChem CID 130282245) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1Z,3Z,6E,8Z)-6-methyl-5-methylidene-10-methyliminodeca-1,3,6,8-tetraen-1-amine.
| Compound Name | (1Z,3Z,6E,8Z)-6-methyl-5-methylidene-10-methyliminodeca-1,3,6,8-tetraen-1-amine |
|---|---|
| PubChem CID | 130282245 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1Z,3Z,6E,8Z)-6-methyl-5-methylidene-10-methyliminodeca-1,3,6,8-tetraen-1-amine |
| SMILES | C=C(/C=C\C=C/N)/C(C)=C/C=C\C=N\C |
| InChI | InChI=1S/C13H18N2/c1-12(8-4-6-10-14)13(2)9-5-7-11-15-3/h4-11H,1,14H2,2-3H3/b7-5-,8-4-,10-6-,13-9+,15-11+ |
| InChIKey | KTBDZHTTXBLIOP-KVHWGTCISA-N |
| XLogP | 2.77 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|