C29H34N4O5S — CID 130282667
4-[(2-methylquinolin-4-yl)methoxy]-N-[3-(2-oxoethyl)-1-(2-piperidin-1-ylacetyl)azetidin-3-yl]benzenesulfonamide (PubChem CID 130282667) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is 4-[(2-methylquinolin-4-yl)methoxy]-N-[3-(2-oxoethyl)-1-(2-piperidin-1-ylacetyl)azetidin-3-yl]benzenesulfonamide.
| Compound Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[3-(2-oxoethyl)-1-(2-piperidin-1-ylacetyl)azetidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 130282667 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 4-[(2-methylquinolin-4-yl)methoxy]-N-[3-(2-oxoethyl)-1-(2-piperidin-1-ylacetyl)azetidin-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)NC3(CC=O)CN(C(=O)CN4CCCCC4)C3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C29H34N4O5S/c1-22-17-23(26-7-3-4-8-27(26)30-22)19-38-24-9-11-25(12-10-24)39(36,37)31-29(13-16-34)20-33(21-29)28(35)18-32-14-5-2-6-15-32/h3-4,7-12,16-17,31H,2,5-6,13-15,18-21H2,1H3 |
| InChIKey | BOPAEJYDOWADGN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|