About 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine
3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine (PubChem CID 130283045) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine.
Molecular Properties
| Compound Name | 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine |
| PubChem CID | 130283045 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine |
| SMILES | C=C/C(=C\CC)OCCCN |
| InChI | InChI=1S/C9H17NO/c1-3-6-9(4-2)11-8-5-7-10/h4,6H,2-3,5,7-8,10H2,1H3/b9-6+ |
| InChIKey | SUVBVCRTNUFCSE-RMKNXTFCSA-N |
| XLogP | 1.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine?
The IUPAC name of 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine (CID 130283045) is 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine.
What is the SMILES notation for 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine?
The canonical SMILES for 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine is C=C/C(=C\CC)OCCCN.
What is the InChIKey of 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine?
The InChIKey is SUVBVCRTNUFCSE-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-6-9(4-2)11-8-5-7-10/h4,6H,2-3,5,7-8,10H2,1H3/b9-6+.
What are the key properties of 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine?
3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine has a molecular weight of 155.24 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-hexa-1,3-dien-3-yl]oxypropan-1-amine is sourced from PubChem (CID 130283045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).