C33H32N2O3 — CID 130283151
3-[(5-carbazol-9-yl-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 130283151) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is 3-[(5-carbazol-9-yl-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(5-carbazol-9-yl-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 130283151 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 3-[(5-carbazol-9-yl-1-hexyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCN1C(=Cc2c(O)c(=O)c2=O)C(C)(C)c2cc(-n3c4ccccc4c4ccccc43)ccc21 |
| InChI | InChI=1S/C33H32N2O3/c1-4-5-6-11-18-34-28-17-16-21(35-26-14-9-7-12-22(26)23-13-8-10-15-27(23)35)19-25(28)33(2,3)29(34)20-24-30(36)32(38)31(24)37/h7-10,12-17,19-20,36H,4-6,11,18H2,1-3H3 |
| InChIKey | GKKVHCAYLCUULZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|