C10H16O2 — CID 130283375
(3S,3aR,6R,6aR)-6a-ethenyl-3,6-dimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan (PubChem CID 130283375) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-6a-ethenyl-3,6-dimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan.
| Compound Name | (3S,3aR,6R,6aR)-6a-ethenyl-3,6-dimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
|---|---|
| PubChem CID | 130283375 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3S,3aR,6R,6aR)-6a-ethenyl-3,6-dimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
| SMILES | C=C[C@]12OC[C@H](C)[C@H]1OC[C@H]2C |
| InChI | InChI=1S/C10H16O2/c1-4-10-8(3)6-11-9(10)7(2)5-12-10/h4,7-9H,1,5-6H2,2-3H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | BFOSPBCPORDQDB-SGIHWFKDSA-N |
| XLogP | 1.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|