C27H31ClFN5S2 — CID 130283381
N-[6-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 130283381) has the molecular formula C27H31ClFN5S2 and a molecular weight of 544.17 g/mol. Its IUPAC name is N-[6-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[6-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130283381 |
| Molecular Formula | C27H31ClFN5S2 |
| Molecular Weight | 544.17 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | N-[6-[1-(3-chloropropylsulfanyl)piperidin-4-yl]-2-ethylimidazo[1,2-a]pyridin-3-yl]-4-(4-fluorophenyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CCc1nc2ccc(C3CCN(SCCCCl)CC3)cn2c1N(C)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C27H31ClFN5S2/c1-3-23-26(32(2)27-31-24(18-35-27)20-5-8-22(29)9-6-20)34-17-21(7-10-25(34)30-23)19-11-14-33(15-12-19)36-16-4-13-28/h5-10,17-19H,3-4,11-16H2,1-2H3 |
| InChIKey | QSTXJHJLDARROA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.17 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|