C19H26N2O — CID 130283409
1-[[9-(2-methylpropyl)-5,6,7,8-tetrahydrocarbazol-3-yl]amino]propan-2-one (PubChem CID 130283409) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[[9-(2-methylpropyl)-5,6,7,8-tetrahydrocarbazol-3-yl]amino]propan-2-one.
| Compound Name | 1-[[9-(2-methylpropyl)-5,6,7,8-tetrahydrocarbazol-3-yl]amino]propan-2-one |
|---|---|
| PubChem CID | 130283409 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[[9-(2-methylpropyl)-5,6,7,8-tetrahydrocarbazol-3-yl]amino]propan-2-one |
| SMILES | CC(=O)CNc1ccc2c(c1)c1c(n2CC(C)C)CCCC1 |
| InChI | InChI=1S/C19H26N2O/c1-13(2)12-21-18-7-5-4-6-16(18)17-10-15(8-9-19(17)21)20-11-14(3)22/h8-10,13,20H,4-7,11-12H2,1-3H3 |
| InChIKey | ZGWNKSGEEHMGEO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|