C22H23ClFN5S2 — CID 130283411
6-N-(3-chloropropylsulfanyl)-2-ethyl-3-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-N-methylimidazo[1,2-a]pyridine-3,6-diamine (PubChem CID 130283411) has the molecular formula C22H23ClFN5S2 and a molecular weight of 476.05 g/mol. Its IUPAC name is 6-N-(3-chloropropylsulfanyl)-2-ethyl-3-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-N-methylimidazo[1,2-a]pyridine-3,6-diamine.
| Compound Name | 6-N-(3-chloropropylsulfanyl)-2-ethyl-3-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-N-methylimidazo[1,2-a]pyridine-3,6-diamine |
|---|---|
| PubChem CID | 130283411 |
| Molecular Formula | C22H23ClFN5S2 |
| Molecular Weight | 476.05 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 6-N-(3-chloropropylsulfanyl)-2-ethyl-3-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-N-methylimidazo[1,2-a]pyridine-3,6-diamine |
| SMILES | CCc1nc2ccc(NSCCCCl)cn2c1N(C)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C22H23ClFN5S2/c1-3-18-21(29-13-17(9-10-20(29)25-18)27-31-12-4-11-23)28(2)22-26-19(14-30-22)15-5-7-16(24)8-6-15/h5-10,13-14,27H,3-4,11-12H2,1-2H3 |
| InChIKey | YYOJBTSNXJCQSL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.05 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|