C32H36FN3O4S — CID 130283439
methyl 2-[(1S,5S,7S)-5-[(5-cyclopropyl-3-spiro[2.5]octan-6-yl-1,2-oxazol-4-yl)methoxy]-2-azatricyclo[5.2.0.01,3]nonan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate (PubChem CID 130283439) has the molecular formula C32H36FN3O4S and a molecular weight of 577.72 g/mol. Its IUPAC name is methyl 2-[(1S,5S,7S)-5-[(5-cyclopropyl-3-spiro[2.5]octan-6-yl-1,2-oxazol-4-yl)methoxy]-2-azatricyclo[5.2.0.01,3]nonan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[(1S,5S,7S)-5-[(5-cyclopropyl-3-spiro[2.5]octan-6-yl-1,2-oxazol-4-yl)methoxy]-2-azatricyclo[5.2.0.01,3]nonan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 130283439 |
| Molecular Formula | C32H36FN3O4S |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | methyl 2-[(1S,5S,7S)-5-[(5-cyclopropyl-3-spiro[2.5]octan-6-yl-1,2-oxazol-4-yl)methoxy]-2-azatricyclo[5.2.0.01,3]nonan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1cc(F)c2nc(N3C4C[C@@H](OCc5c(C6CCC7(CC6)CC7)noc5C5CC5)C[C@@H]5CC[C@@]453)sc2c1 |
| InChI | InChI=1S/C32H36FN3O4S/c1-38-29(37)19-12-23(33)27-24(13-19)41-30(34-27)36-25-15-21(14-20-6-9-32(20,25)36)39-16-22-26(35-40-28(22)18-2-3-18)17-4-7-31(8-5-17)10-11-31/h12-13,17-18,20-21,25H,2-11,14-16H2,1H3/t20-,21-,25?,32-,36?/m0/s1 |
| InChIKey | CRXANMVBOHLTCZ-DSPNUIHLSA-N |
| XLogP | 7.24 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|