C46H49NO2 — CID 130283528
4-[4-[6-[2-(1,3,3,5,5-pentamethylcyclohexyl)phenyl]-2-phenylbenzo[h]chromen-2-yl]phenyl]morpholine (PubChem CID 130283528) has the molecular formula C46H49NO2 and a molecular weight of 647.90 g/mol. Its IUPAC name is 4-[4-[6-[2-(1,3,3,5,5-pentamethylcyclohexyl)phenyl]-2-phenylbenzo[h]chromen-2-yl]phenyl]morpholine.
| Compound Name | 4-[4-[6-[2-(1,3,3,5,5-pentamethylcyclohexyl)phenyl]-2-phenylbenzo[h]chromen-2-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 130283528 |
| Molecular Formula | C46H49NO2 |
| Molecular Weight | 647.90 g/mol |
| Exact Mass | 647.38 |
| IUPAC Name | 4-[4-[6-[2-(1,3,3,5,5-pentamethylcyclohexyl)phenyl]-2-phenylbenzo[h]chromen-2-yl]phenyl]morpholine |
| SMILES | CC1(C)CC(C)(C)CC(C)(c2ccccc2-c2cc3c(c4ccccc24)OC(c2ccccc2)(c2ccc(N4CCOCC4)cc2)C=C3)C1 |
| InChI | InChI=1S/C46H49NO2/c1-43(2)30-44(3,4)32-45(5,31-43)41-18-12-11-16-38(41)40-29-33-23-24-46(34-13-7-6-8-14-34,49-42(33)39-17-10-9-15-37(39)40)35-19-21-36(22-20-35)47-25-27-48-28-26-47/h6-24,29H,25-28,30-32H2,1-5H3 |
| InChIKey | NHCLYYVTCYWAQC-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.90 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|