C21H37N3 — CID 130283594
2-[(5Z)-4,8-dimethylnona-5,7-dienyl]-1-[(2E)-3-ethyl-5-methylhexa-2,5-dien-2-yl]guanidine (PubChem CID 130283594) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 2-[(5Z)-4,8-dimethylnona-5,7-dienyl]-1-[(2E)-3-ethyl-5-methylhexa-2,5-dien-2-yl]guanidine.
| Compound Name | 2-[(5Z)-4,8-dimethylnona-5,7-dienyl]-1-[(2E)-3-ethyl-5-methylhexa-2,5-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 130283594 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 2-[(5Z)-4,8-dimethylnona-5,7-dienyl]-1-[(2E)-3-ethyl-5-methylhexa-2,5-dien-2-yl]guanidine |
| SMILES | C=C(C)C/C(CC)=C(\C)N/C(N)=N/CCCC(C)/C=C\C=C(C)C |
| InChI | InChI=1S/C21H37N3/c1-8-20(15-17(4)5)19(7)24-21(22)23-14-10-13-18(6)12-9-11-16(2)3/h9,11-12,18H,4,8,10,13-15H2,1-3,5-7H3,(H3,22,23,24)/b12-9-,20-19+ |
| InChIKey | XUYMBKZRLJSQCR-ZZKRVRPKSA-N |
| XLogP | 5.48 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|