C23H23FN6O4 — CID 130284220
6-[(1R)-1-[8-fluoro-6-(3-methyl-2,3-dihydro-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2-methoxyethoxy)-1,6-naphthyridin-5-one (PubChem CID 130284220) has the molecular formula C23H23FN6O4 and a molecular weight of 466.47 g/mol. Its IUPAC name is 6-[(1R)-1-[8-fluoro-6-(3-methyl-2,3-dihydro-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2-methoxyethoxy)-1,6-naphthyridin-5-one.
| Compound Name | 6-[(1R)-1-[8-fluoro-6-(3-methyl-2,3-dihydro-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2-methoxyethoxy)-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 130284220 |
| Molecular Formula | C23H23FN6O4 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 6-[(1R)-1-[8-fluoro-6-(3-methyl-2,3-dihydro-1,2-oxazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]ethyl]-3-(2-methoxyethoxy)-1,6-naphthyridin-5-one |
| SMILES | COCCOc1cnc2ccn([C@H](C)c3nnc4c(F)cc(C5=CC(C)NO5)cn34)c(=O)c2c1 |
| InChI | InChI=1S/C23H23FN6O4/c1-13-8-20(34-28-13)15-9-18(24)22-27-26-21(30(22)12-15)14(2)29-5-4-19-17(23(29)31)10-16(11-25-19)33-7-6-32-3/h4-5,8-14,28H,6-7H2,1-3H3/t13?,14-/m1/s1 |
| InChIKey | NAAMRHDPTCIQOL-ARLHGKGLSA-N |
| XLogP | 2.48 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|