C16H29N — CID 130284664
2,3,4,5-tetramethyl-1-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]piperidine (PubChem CID 130284664) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-1-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]piperidine.
| Compound Name | 2,3,4,5-tetramethyl-1-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]piperidine |
|---|---|
| PubChem CID | 130284664 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2,3,4,5-tetramethyl-1-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]piperidine |
| SMILES | C=C/C(=C\N1CC(C)C(C)C(C)C1C)C(C)C |
| InChI | InChI=1S/C16H29N/c1-8-16(11(2)3)10-17-9-12(4)13(5)14(6)15(17)7/h8,10-15H,1,9H2,2-7H3/b16-10+ |
| InChIKey | OUDXSQNUDOOPQO-MHWRWJLKSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|