C17H22ClN5O2S — CID 130284890
3-(4-chloroanilino)-1-[4-(methanesulfinamido)cyclohexyl]pyrazole-4-carboxamide (PubChem CID 130284890) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is 3-(4-chloroanilino)-1-[4-(methanesulfinamido)cyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-chloroanilino)-1-[4-(methanesulfinamido)cyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 130284890 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-(4-chloroanilino)-1-[4-(methanesulfinamido)cyclohexyl]pyrazole-4-carboxamide |
| SMILES | CS(=O)NC1CCC(n2cc(C(N)=O)c(Nc3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C17H22ClN5O2S/c1-26(25)22-13-6-8-14(9-7-13)23-10-15(16(19)24)17(21-23)20-12-4-2-11(18)3-5-12/h2-5,10,13-14,22H,6-9H2,1H3,(H2,19,24)(H,20,21) |
| InChIKey | ATJSWIIGPFRESF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |