C9H13NO — CID 130285236
3-methyl-2,4,5,6-tetrahydro-1,3-benzoxazine (PubChem CID 130285236) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-methyl-2,4,5,6-tetrahydro-1,3-benzoxazine.
| Compound Name | 3-methyl-2,4,5,6-tetrahydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 130285236 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-methyl-2,4,5,6-tetrahydro-1,3-benzoxazine |
| SMILES | CN1COC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C9H13NO/c1-10-6-8-4-2-3-5-9(8)11-7-10/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | KZHYLLLWCUXPQC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |