About 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline
4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline (PubChem CID 130285815) has the molecular formula C21H28ClN3O
and a molecular weight of 373.93 g/mol. Its IUPAC name is 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline.
Molecular Properties
| Compound Name | 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline |
| PubChem CID | 130285815 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline |
| SMILES | COc1c(/N=N/c2cc(Cl)ccc2N)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C21H28ClN3O/c1-20(2,3)13-10-15(21(4,5)6)19(26-7)18(11-13)25-24-17-12-14(22)8-9-16(17)23/h8-12H,23H2,1-7H3/b25-24+ |
| InChIKey | WEJBMUIPVFGRQE-OCOZRVBESA-N |
| XLogP | 6.94 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline?
The IUPAC name of 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline (CID 130285815) is 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline.
What is the SMILES notation for 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline?
The canonical SMILES for 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline is COc1c(/N=N/c2cc(Cl)ccc2N)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline?
The InChIKey is WEJBMUIPVFGRQE-OCOZRVBESA-N. The full InChI is InChI=1S/C21H28ClN3O/c1-20(2,3)13-10-15(21(4,5)6)19(26-7)18(11-13)25-24-17-12-14(22)8-9-16(17)23/h8-12H,23H2,1-7H3/b25-24+.
What are the key properties of 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline?
4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline has a molecular weight of 373.93 g/mol, XLogP of 6.94, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(3,5-ditert-butyl-2-methoxyphenyl)diazenyl]aniline is sourced from PubChem (CID 130285815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).