C18H17N3O2 — CID 130286743
(Z)-2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)-3-(6-methoxy-3-pyridinyl)prop-2-enenitrile (PubChem CID 130286743) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (Z)-2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)-3-(6-methoxy-3-pyridinyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)-3-(6-methoxy-3-pyridinyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 130286743 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (Z)-2-(5-methoxy-3a,7a-dihydro-1H-indol-3-yl)-3-(6-methoxy-3-pyridinyl)prop-2-enenitrile |
| SMILES | COC1=CC2C(/C(C#N)=C/c3ccc(OC)nc3)=CNC2C=C1 |
| InChI | InChI=1S/C18H17N3O2/c1-22-14-4-5-17-15(8-14)16(11-20-17)13(9-19)7-12-3-6-18(23-2)21-10-12/h3-8,10-11,15,17,20H,1-2H3/b13-7+ |
| InChIKey | AISIDSOYPJRVCO-NTUHNPAUSA-N |
| XLogP | 2.57 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|