C29H31N3O4S — CID 130286880
(17S)-17-[(4-methoxy-N-methylanilino)methyl]-3,3-dioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaen-15-one (PubChem CID 130286880) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is (17S)-17-[(4-methoxy-N-methylanilino)methyl]-3,3-dioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaen-15-one.
| Compound Name | (17S)-17-[(4-methoxy-N-methylanilino)methyl]-3,3-dioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaen-15-one |
|---|---|
| PubChem CID | 130286880 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (17S)-17-[(4-methoxy-N-methylanilino)methyl]-3,3-dioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaen-15-one |
| SMILES | COc1ccc(N(C)C[C@@H]2Cc3cccc(c3)CS(=O)(=O)Cc3[nH]c4ccccc4c3CC(=O)N2)cc1 |
| InChI | InChI=1S/C29H31N3O4S/c1-32(23-10-12-24(36-2)13-11-23)17-22-15-20-6-5-7-21(14-20)18-37(34,35)19-28-26(16-29(33)30-22)25-8-3-4-9-27(25)31-28/h3-14,22,31H,15-19H2,1-2H3,(H,30,33)/t22-/m0/s1 |
| InChIKey | QVSBZQULHXYREC-QFIPXVFZSA-N |
| XLogP | 4.01 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|