C23H32N2O3S — CID 130287111
N-(7-methoxyheptyl)-3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 130287111) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-(7-methoxyheptyl)-3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | N-(7-methoxyheptyl)-3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 130287111 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-(7-methoxyheptyl)-3,6-dimethyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | COCCCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C23H32N2O3S/c1-18-13-14-20-22(17-18)29(26,27)25(2)21-12-8-7-11-19(21)23(20)24-15-9-5-4-6-10-16-28-3/h7-8,11-14,17,23-24H,4-6,9-10,15-16H2,1-3H3 |
| InChIKey | ASYVXXNRPPOEKM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|