C25H33NO3 — CID 130287677
(3Z)-3-[2-[2-(2-ethoxyethoxy)ethyl]-6H-benzo[c][1]benzoxepin-11-ylidene]-N,N-dimethylpropan-1-amine (PubChem CID 130287677) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (3Z)-3-[2-[2-(2-ethoxyethoxy)ethyl]-6H-benzo[c][1]benzoxepin-11-ylidene]-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-[2-[2-(2-ethoxyethoxy)ethyl]-6H-benzo[c][1]benzoxepin-11-ylidene]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 130287677 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (3Z)-3-[2-[2-(2-ethoxyethoxy)ethyl]-6H-benzo[c][1]benzoxepin-11-ylidene]-N,N-dimethylpropan-1-amine |
| SMILES | CCOCCOCCc1ccc2c(c1)/C(=C\CCN(C)C)c1ccccc1CO2 |
| InChI | InChI=1S/C25H33NO3/c1-4-27-16-17-28-15-13-20-11-12-25-24(18-20)23(10-7-14-26(2)3)22-9-6-5-8-21(22)19-29-25/h5-6,8-12,18H,4,7,13-17,19H2,1-3H3/b23-10- |
| InChIKey | HNDCCHKMBCPRKU-RMORIDSASA-N |
| XLogP | 4.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|