About methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate
methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate (PubChem CID 130288127) has the molecular formula C21H16Cl2N2O3
and a molecular weight of 415.28 g/mol. Its IUPAC name is methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate |
| PubChem CID | 130288127 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H](NC(=O)c2ccc(Cl)c(Cl)c2)c2ccccc2)nc1 |
| InChI | InChI=1S/C21H16Cl2N2O3/c1-28-21(27)15-8-10-18(24-12-15)19(13-5-3-2-4-6-13)25-20(26)14-7-9-16(22)17(23)11-14/h2-12,19H,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | JIKCVOMDUGDBKH-IBGZPJMESA-N |
| XLogP | 4.69 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate (CID 130288127) is methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate is COC(=O)c1ccc([C@@H](NC(=O)c2ccc(Cl)c(Cl)c2)c2ccccc2)nc1.
What is the InChIKey of methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate?
The InChIKey is JIKCVOMDUGDBKH-IBGZPJMESA-N. The full InChI is InChI=1S/C21H16Cl2N2O3/c1-28-21(27)15-8-10-18(24-12-15)19(13-5-3-2-4-6-13)25-20(26)14-7-9-16(22)17(23)11-14/h2-12,19H,1H3,(H,25,26)/t19-/m0/s1.
What are the key properties of methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate?
methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate has a molecular weight of 415.28 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(S)-[(3,4-dichlorobenzoyl)amino]-phenylmethyl]pyridine-3-carboxylate is sourced from PubChem (CID 130288127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).