C35H41FN2O3 — CID 130288305
(2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]-4-(5-fluoro-2-methyl-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid (PubChem CID 130288305) has the molecular formula C35H41FN2O3 and a molecular weight of 556.72 g/mol. Its IUPAC name is (2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]-4-(5-fluoro-2-methyl-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid.
| Compound Name | (2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]-4-(5-fluoro-2-methyl-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 130288305 |
| Molecular Formula | C35H41FN2O3 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | (2S,3R)-3-cyclopropyl-3-[2-[3-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]-4-(5-fluoro-2-methyl-4-pyridinyl)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid |
| SMILES | Cc1cc(-c2ccc(C3CCc4ccc([C@H](C5CC5)[C@H](C)C(=O)O)cc4O3)cc2CN2[C@H](C)CC[C@H]2C)c(F)cn1 |
| InChI | InChI=1S/C35H41FN2O3/c1-20-15-30(31(36)18-37-20)29-13-11-26(16-28(29)19-38-21(2)5-6-22(38)3)32-14-12-24-7-10-27(17-33(24)41-32)34(25-8-9-25)23(4)35(39)40/h7,10-11,13,15-18,21-23,25,32,34H,5-6,8-9,12,14,19H2,1-4H3,(H,39,40)/t21-,22-,23+,32?,34+/m1/s1 |
| InChIKey | HSARXQCGHIYBKB-GKMCIEHOSA-N |
| XLogP | 7.85 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |