C24H22N6O3S — CID 1302884
N'-[2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-methylbenzohydrazide (PubChem CID 1302884) has the molecular formula C24H22N6O3S and a molecular weight of 474.55 g/mol. Its IUPAC name is N'-[2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-methylbenzohydrazide.
| Compound Name | N'-[2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 1302884 |
| Molecular Formula | C24H22N6O3S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N'-[2-[[4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-methylbenzohydrazide |
| SMILES | COc1ccc(-n2c(SCC(=O)NNC(=O)c3ccccc3C)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C24H22N6O3S/c1-16-5-3-4-6-20(16)23(32)28-26-21(31)15-34-24-29-27-22(17-11-13-25-14-12-17)30(24)18-7-9-19(33-2)10-8-18/h3-14H,15H2,1-2H3,(H,26,31)(H,28,32) |
| InChIKey | DMGQONVNOXEMKX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|