About 9,10-dihydrophenanthrene-9,10-dicarbonitrile
9,10-dihydrophenanthrene-9,10-dicarbonitrile (PubChem CID 13028861) has the molecular formula C16H10N2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 9,10-dihydrophenanthrene-9,10-dicarbonitrile.
Molecular Properties
| Compound Name | 9,10-dihydrophenanthrene-9,10-dicarbonitrile |
| PubChem CID | 13028861 |
| Molecular Formula | C16H10N2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 9,10-dihydrophenanthrene-9,10-dicarbonitrile |
| SMILES | N#CC1c2ccccc2-c2ccccc2C1C#N |
| InChI | InChI=1S/C16H10N2/c17-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)16(15)10-18/h1-8,15-16H |
| InChIKey | NXEUPFDNVSTAAI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-dihydrophenanthrene-9,10-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dihydrophenanthrene-9,10-dicarbonitrile?
The IUPAC name of 9,10-dihydrophenanthrene-9,10-dicarbonitrile (CID 13028861) is 9,10-dihydrophenanthrene-9,10-dicarbonitrile.
What is the SMILES notation for 9,10-dihydrophenanthrene-9,10-dicarbonitrile?
The canonical SMILES for 9,10-dihydrophenanthrene-9,10-dicarbonitrile is N#CC1c2ccccc2-c2ccccc2C1C#N.
What is the InChIKey of 9,10-dihydrophenanthrene-9,10-dicarbonitrile?
The InChIKey is NXEUPFDNVSTAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2/c17-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)16(15)10-18/h1-8,15-16H.
What are the key properties of 9,10-dihydrophenanthrene-9,10-dicarbonitrile?
9,10-dihydrophenanthrene-9,10-dicarbonitrile has a molecular weight of 230.27 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dihydrophenanthrene-9,10-dicarbonitrile is sourced from PubChem (CID 13028861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).